C30H32FN5O5S — CID 121251654
N-[(6-amino-2-pyridinyl)sulfonyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-pyridin-2-ylbutoxy)pyridine-3-carboxamide (PubChem CID 121251654) has the molecular formula C30H32FN5O5S and a molecular weight of 593.68 g/mol. Its IUPAC name is N-[(6-amino-2-pyridinyl)sulfonyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-pyridin-2-ylbutoxy)pyridine-3-carboxamide.
| Compound Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-pyridin-2-ylbutoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121251654 |
| Molecular Formula | C30H32FN5O5S |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-pyridin-2-ylbutoxy)pyridine-3-carboxamide |
| SMILES | CC(C)COc1cc(F)cc(-c2ccc(C(=O)NS(=O)(=O)c3cccc(N)n3)c(OCCCCc3ccccn3)n2)c1 |
| InChI | InChI=1S/C30H32FN5O5S/c1-20(2)19-41-24-17-21(16-22(31)18-24)26-13-12-25(29(37)36-42(38,39)28-11-7-10-27(32)35-28)30(34-26)40-15-6-4-9-23-8-3-5-14-33-23/h3,5,7-8,10-14,16-18,20H,4,6,9,15,19H2,1-2H3,(H2,32,35)(H,36,37) |
| InChIKey | FYUNEATTZRJFTK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|