About 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid
4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid (PubChem CID 121251664) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid |
| PubChem CID | 121251664 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid |
| SMILES | Cc1cc(C)c(Cn2cc(C(C)(C)C)nc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C18H24N2O2/c1-11-7-12(2)14(13(3)8-11)9-20-10-15(18(4,5)6)19-16(20)17(21)22/h7-8,10H,9H2,1-6H3,(H,21,22) |
| InChIKey | NNJNFIHHAJDORY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid?
The IUPAC name of 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid (CID 121251664) is 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid.
What is the SMILES notation for 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid?
The canonical SMILES for 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid is Cc1cc(C)c(Cn2cc(C(C)(C)C)nc2C(=O)O)c(C)c1.
What is the InChIKey of 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid?
The InChIKey is NNJNFIHHAJDORY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-11-7-12(2)14(13(3)8-11)9-20-10-15(18(4,5)6)19-16(20)17(21)22/h7-8,10H,9H2,1-6H3,(H,21,22).
What are the key properties of 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid?
4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid has a molecular weight of 300.40 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-[(2,4,6-trimethylphenyl)methyl]imidazole-2-carboxylic acid is sourced from PubChem (CID 121251664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).