C18H22ClN5O3S — CID 121251791
N-[(6-amino-2-pyridinyl)sulfonyl]-6-chloro-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide (PubChem CID 121251791) has the molecular formula C18H22ClN5O3S and a molecular weight of 423.93 g/mol. Its IUPAC name is N-[(6-amino-2-pyridinyl)sulfonyl]-6-chloro-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-chloro-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121251791 |
| Molecular Formula | C18H22ClN5O3S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-chloro-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CN(c2nc(Cl)ccc2C(=O)NS(=O)(=O)c2cccc(N)n2)C(C)(C)C1 |
| InChI | InChI=1S/C18H22ClN5O3S/c1-11-9-18(2,3)24(10-11)16-12(7-8-13(19)21-16)17(25)23-28(26,27)15-6-4-5-14(20)22-15/h4-8,11H,9-10H2,1-3H3,(H2,20,22)(H,23,25) |
| InChIKey | SZOFGPVSFRGILO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|