C18H27N5O5 — CID 121253423
1-methyl-4-[[2-[[(3S,4R)-3-methyloxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid (PubChem CID 121253423) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-methyl-4-[[2-[[(3S,4R)-3-methyloxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-methyl-4-[[2-[[(3S,4R)-3-methyloxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121253423 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-methyl-4-[[2-[[(3S,4R)-3-methyloxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid |
| SMILES | C[C@@H]1COCC[C@H]1Nc1ncc([N+](=O)[O-])c(NC2CCC(C)(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C18H27N5O5/c1-11-10-28-8-5-13(11)21-17-19-9-14(23(26)27)15(22-17)20-12-3-6-18(2,7-4-12)16(24)25/h9,11-13H,3-8,10H2,1-2H3,(H,24,25)(H2,19,20,21,22)/t11-,12?,13-,18?/m1/s1 |
| InChIKey | FNOTVQWNRRAEJM-LLFUWHRMSA-N |
| XLogP | 2.67 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|