C24H31N5O2 — CID 121254771
1-N-[6-[5-(2-methoxyethoxy)-3-pyridinyl]quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine (PubChem CID 121254771) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-N-[6-[5-(2-methoxyethoxy)-3-pyridinyl]quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine.
| Compound Name | 1-N-[6-[5-(2-methoxyethoxy)-3-pyridinyl]quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 121254771 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-N-[6-[5-(2-methoxyethoxy)-3-pyridinyl]quinazolin-4-yl]-4-N,4-N-dimethylcyclohexane-1,4-diamine |
| SMILES | COCCOc1cncc(-c2ccc3ncnc(NC4CCC(N(C)C)CC4)c3c2)c1 |
| InChI | InChI=1S/C24H31N5O2/c1-29(2)20-7-5-19(6-8-20)28-24-22-13-17(4-9-23(22)26-16-27-24)18-12-21(15-25-14-18)31-11-10-30-3/h4,9,12-16,19-20H,5-8,10-11H2,1-3H3,(H,26,27,28) |
| InChIKey | LCWPQWBNOUNINY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|