C29H41N3O5 — CID 121254912
1-[(2S)-2-[[(2S)-2-benzamido-2-cyclohexylacetyl]amino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid (PubChem CID 121254912) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is 1-[(2S)-2-[[(2S)-2-benzamido-2-cyclohexylacetyl]amino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid.
| Compound Name | 1-[(2S)-2-[[(2S)-2-benzamido-2-cyclohexylacetyl]amino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 121254912 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 1-[(2S)-2-[[(2S)-2-benzamido-2-cyclohexylacetyl]amino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@@H](NC(=O)c1ccccc1)C1CCCCC1)C(=O)N1C(C(=O)O)CC2CCCC21 |
| InChI | InChI=1S/C29H41N3O5/c1-29(2,3)24(27(35)32-21-16-10-15-20(21)17-22(32)28(36)37)31-26(34)23(18-11-6-4-7-12-18)30-25(33)19-13-8-5-9-14-19/h5,8-9,13-14,18,20-24H,4,6-7,10-12,15-17H2,1-3H3,(H,30,33)(H,31,34)(H,36,37)/t20?,21?,22?,23-,24+/m0/s1 |
| InChIKey | OKDOGUAYJZOZMG-QGOPKKHISA-N |
| XLogP | 3.75 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |