About 2,2-bis(ethenyl)oxolane
2,2-bis(ethenyl)oxolane (PubChem CID 121255179) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 2,2-bis(ethenyl)oxolane.
Molecular Properties
| Compound Name | 2,2-bis(ethenyl)oxolane |
| PubChem CID | 121255179 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 2,2-bis(ethenyl)oxolane |
| SMILES | C=CC1(C=C)CCCO1 |
| InChI | InChI=1S/C8H12O/c1-3-8(4-2)6-5-7-9-8/h3-4H,1-2,5-7H2 |
| InChIKey | NWRQECKGIJYTPP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(ethenyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(ethenyl)oxolane?
The IUPAC name of 2,2-bis(ethenyl)oxolane (CID 121255179) is 2,2-bis(ethenyl)oxolane.
What is the SMILES notation for 2,2-bis(ethenyl)oxolane?
The canonical SMILES for 2,2-bis(ethenyl)oxolane is C=CC1(C=C)CCCO1.
What is the InChIKey of 2,2-bis(ethenyl)oxolane?
The InChIKey is NWRQECKGIJYTPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-3-8(4-2)6-5-7-9-8/h3-4H,1-2,5-7H2.
What are the key properties of 2,2-bis(ethenyl)oxolane?
2,2-bis(ethenyl)oxolane has a molecular weight of 124.18 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(ethenyl)oxolane is sourced from PubChem (CID 121255179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).