About [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid
[3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid (PubChem CID 121255435) has the molecular formula C17H25N3O6
and a molecular weight of 367.40 g/mol. Its IUPAC name is [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid.
Molecular Properties
| Compound Name | [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid |
| PubChem CID | 121255435 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid |
| SMILES | COc1cc(NC(=O)O)cc(OC)c1C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H25N3O6/c1-24-13-10-12(19-17(22)23)11-14(25-2)15(13)16(21)18-4-3-5-20-6-8-26-9-7-20/h10-11,19H,3-9H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | STRATTCRSSNCNS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid?
The IUPAC name of [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid (CID 121255435) is [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid.
What is the SMILES notation for [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid?
The canonical SMILES for [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid is COc1cc(NC(=O)O)cc(OC)c1C(=O)NCCCN1CCOCC1.
What is the InChIKey of [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid?
The InChIKey is STRATTCRSSNCNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O6/c1-24-13-10-12(19-17(22)23)11-14(25-2)15(13)16(21)18-4-3-5-20-6-8-26-9-7-20/h10-11,19H,3-9H2,1-2H3,(H,18,21)(H,22,23).
What are the key properties of [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid?
[3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid has a molecular weight of 367.40 g/mol, XLogP of 1.25, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethoxy-4-(3-morpholin-4-ylpropylcarbamoyl)phenyl]carbamic acid is sourced from PubChem (CID 121255435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).