About O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate
O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate (PubChem CID 121256318) has the molecular formula C6H11NOS2
and a molecular weight of 177.29 g/mol. Its IUPAC name is O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate |
| PubChem CID | 121256318 |
| Molecular Formula | C6H11NOS2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)O[C@H]1CCNC1 |
| InChI | InChI=1S/C6H11NOS2/c1-10-6(9)8-5-2-3-7-4-5/h5,7H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | AQXMWCWFHZKRNJ-YFKPBYRVSA-N |
| XLogP | 1.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate?
The IUPAC name of O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate (CID 121256318) is O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate.
What is the SMILES notation for O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate?
The canonical SMILES for O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate is CSC(=S)O[C@H]1CCNC1.
What is the InChIKey of O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate?
The InChIKey is AQXMWCWFHZKRNJ-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11NOS2/c1-10-6(9)8-5-2-3-7-4-5/h5,7H,2-4H2,1H3/t5-/m0/s1.
What are the key properties of O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate?
O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate has a molecular weight of 177.29 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(3S)-pyrrolidin-3-yl] methylsulfanylmethanethioate is sourced from PubChem (CID 121256318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).