C16H15NO5S — CID 121256340
(3a-benzoylsulfanyl-1,3-dioxo-4,5,6,6a-tetrahydrocyclopenta[c]pyrrol-6-yl) acetate (PubChem CID 121256340) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is (3a-benzoylsulfanyl-1,3-dioxo-4,5,6,6a-tetrahydrocyclopenta[c]pyrrol-6-yl) acetate.
| Compound Name | (3a-benzoylsulfanyl-1,3-dioxo-4,5,6,6a-tetrahydrocyclopenta[c]pyrrol-6-yl) acetate |
|---|---|
| PubChem CID | 121256340 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (3a-benzoylsulfanyl-1,3-dioxo-4,5,6,6a-tetrahydrocyclopenta[c]pyrrol-6-yl) acetate |
| SMILES | CC(=O)OC1CCC2(SC(=O)c3ccccc3)C(=O)NC(=O)C12 |
| InChI | InChI=1S/C16H15NO5S/c1-9(18)22-11-7-8-16(12(11)13(19)17-15(16)21)23-14(20)10-5-3-2-4-6-10/h2-6,11-12H,7-8H2,1H3,(H,17,19,21) |
| InChIKey | YUZAEMWRZAMLMG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|