C18H27F3O2 — CID 121257119
(3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5,6-trimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene (PubChem CID 121257119) has the molecular formula C18H27F3O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is (3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5,6-trimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene.
| Compound Name | (3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5,6-trimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene |
|---|---|
| PubChem CID | 121257119 |
| Molecular Formula | C18H27F3O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5,6-trimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene |
| SMILES | CO[C@H]1/C=C/CC/C(C(F)(F)F)=C/COC/C(C)=C\[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H27F3O2/c1-13-11-14(2)15(3)17(22-4)8-6-5-7-16(18(19,20)21)9-10-23-12-13/h6,8-9,11,14-15,17H,5,7,10,12H2,1-4H3/b8-6+,13-11-,16-9-/t14-,15+,17+/m1/s1 |
| InChIKey | BWCMOWWEHYNWHQ-ZVCBXTLNSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|