About 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine
4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine (PubChem CID 121257609) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine |
| PubChem CID | 121257609 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine |
| SMILES | CC1=CNCC(CN2CCOCC2)=C1 |
| InChI | InChI=1S/C11H18N2O/c1-10-6-11(8-12-7-10)9-13-2-4-14-5-3-13/h6-7,12H,2-5,8-9H2,1H3 |
| InChIKey | IMZNENRNXGKZMH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine?
The IUPAC name of 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine (CID 121257609) is 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine.
What is the SMILES notation for 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine?
The canonical SMILES for 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine is CC1=CNCC(CN2CCOCC2)=C1.
What is the InChIKey of 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine?
The InChIKey is IMZNENRNXGKZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-10-6-11(8-12-7-10)9-13-2-4-14-5-3-13/h6-7,12H,2-5,8-9H2,1H3.
What are the key properties of 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine?
4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine has a molecular weight of 194.28 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-1,2-dihydropyridin-3-yl)methyl]morpholine is sourced from PubChem (CID 121257609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).