C23H23F3N6O2S — CID 121257642
N,N,4-trimethyl-2-[[1-methyl-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[2,3-b]pyrazine-4-carbonyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 121257642) has the molecular formula C23H23F3N6O2S and a molecular weight of 504.54 g/mol. Its IUPAC name is N,N,4-trimethyl-2-[[1-methyl-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[2,3-b]pyrazine-4-carbonyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-[[1-methyl-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[2,3-b]pyrazine-4-carbonyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 121257642 |
| Molecular Formula | C23H23F3N6O2S |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N,N,4-trimethyl-2-[[1-methyl-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[2,3-b]pyrazine-4-carbonyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)N2CCN(C)c3ccc(-c4cccc(C(F)(F)F)c4)nc32)sc1C(=O)N(C)C |
| InChI | InChI=1S/C23H23F3N6O2S/c1-13-18(20(33)30(2)3)35-21(27-13)29-22(34)32-11-10-31(4)17-9-8-16(28-19(17)32)14-6-5-7-15(12-14)23(24,25)26/h5-9,12H,10-11H2,1-4H3,(H,27,29,34) |
| InChIKey | SEVJOIACVKLCLU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |