C23H29F3N6O3 — CID 121257925
1-[3-[7-[[2-[2-methoxyethyl(methyl)amino]ethoxyamino]methyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 121257925) has the molecular formula C23H29F3N6O3 and a molecular weight of 494.52 g/mol. Its IUPAC name is 1-[3-[7-[[2-[2-methoxyethyl(methyl)amino]ethoxyamino]methyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[[2-[2-methoxyethyl(methyl)amino]ethoxyamino]methyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 121257925 |
| Molecular Formula | C23H29F3N6O3 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1-[3-[7-[[2-[2-methoxyethyl(methyl)amino]ethoxyamino]methyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COCCN(C)CCONCc1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C23H29F3N6O3/c1-31(8-10-34-2)9-11-35-29-14-17-6-7-32-20(15-27-21(32)12-17)18-4-3-5-19(13-18)30-22(33)28-16-23(24,25)26/h3-7,12-13,15,29H,8-11,14,16H2,1-2H3,(H2,28,30,33) |
| InChIKey | WNSSZYJGNZHBDT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|