C32H20F3N3O3S — CID 121258089
[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 121258089) has the molecular formula C32H20F3N3O3S and a molecular weight of 583.59 g/mol. Its IUPAC name is [8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121258089 |
| Molecular Formula | C32H20F3N3O3S |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | [8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2cccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c2c1)C(F)(F)F |
| InChI | InChI=1S/C32H20F3N3O3S/c33-32(34,35)42(39,40)41-26-19-18-21-12-7-13-27(28(21)20-26)22-14-16-25(17-15-22)31-37-29(23-8-3-1-4-9-23)36-30(38-31)24-10-5-2-6-11-24/h1-20H |
| InChIKey | DZNUCVZJKXNCFK-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|