C16H18BrN5O3 — CID 121258187
[4-[(4-amino-5-bromopyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone (PubChem CID 121258187) has the molecular formula C16H18BrN5O3 and a molecular weight of 408.26 g/mol. Its IUPAC name is [4-[(4-amino-5-bromopyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(4-amino-5-bromopyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 121258187 |
| Molecular Formula | C16H18BrN5O3 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [4-[(4-amino-5-bromopyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone |
| SMILES | COc1cc(C(=O)N2CCOCC2)ccc1Nc1ncc(Br)c(N)n1 |
| InChI | InChI=1S/C16H18BrN5O3/c1-24-13-8-10(15(23)22-4-6-25-7-5-22)2-3-12(13)20-16-19-9-11(17)14(18)21-16/h2-3,8-9H,4-7H2,1H3,(H3,18,19,20,21) |
| InChIKey | HSGUUYYBGWMRCS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |