About 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane
5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane (PubChem CID 121258261) has the molecular formula C16H22F6O
and a molecular weight of 344.34 g/mol. Its IUPAC name is 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane.
Molecular Properties
| Compound Name | 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane |
| PubChem CID | 121258261 |
| Molecular Formula | C16H22F6O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane |
| SMILES | C/C=C/C1CCC(C(F)(F)OC2CC(F)C(F)C(F)C2)C(F)C1 |
| InChI | InChI=1S/C16H22F6O/c1-2-3-9-4-5-11(12(17)6-9)16(21,22)23-10-7-13(18)15(20)14(19)8-10/h2-3,9-15H,4-8H2,1H3/b3-2+ |
| InChIKey | VURZBRSAHJBYOK-NSCUHMNNSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
The IUPAC name of 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane (CID 121258261) is 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane.
What is the SMILES notation for 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
The canonical SMILES for 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane is C/C=C/C1CCC(C(F)(F)OC2CC(F)C(F)C(F)C2)C(F)C1.
What is the InChIKey of 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
The InChIKey is VURZBRSAHJBYOK-NSCUHMNNSA-N. The full InChI is InChI=1S/C16H22F6O/c1-2-3-9-4-5-11(12(17)6-9)16(21,22)23-10-7-13(18)15(20)14(19)8-10/h2-3,9-15H,4-8H2,1H3/b3-2+.
What are the key properties of 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane has a molecular weight of 344.34 g/mol, XLogP of 5.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[difluoro-[2-fluoro-4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane is sourced from PubChem (CID 121258261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).