C17H16F3NO2S — CID 121258319
7-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)phenothiazine 5,5-dioxide (PubChem CID 121258319) has the molecular formula C17H16F3NO2S and a molecular weight of 355.38 g/mol. Its IUPAC name is 7-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)phenothiazine 5,5-dioxide.
| Compound Name | 7-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)phenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 121258319 |
| Molecular Formula | C17H16F3NO2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 7-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)phenothiazine 5,5-dioxide |
| SMILES | CCc1ccc2c(c1)S(=O)(=O)c1ccc(C)cc1N2CC(F)(F)F |
| InChI | InChI=1S/C17H16F3NO2S/c1-3-12-5-6-13-16(9-12)24(22,23)15-7-4-11(2)8-14(15)21(13)10-17(18,19)20/h4-9H,3,10H2,1-2H3 |
| InChIKey | AXNFOCDEHVZRHM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |