About 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one
6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one (PubChem CID 121258325) has the molecular formula C18H16F3NO
and a molecular weight of 319.33 g/mol. Its IUPAC name is 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one.
Molecular Properties
| Compound Name | 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one |
| PubChem CID | 121258325 |
| Molecular Formula | C18H16F3NO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one |
| SMILES | CCc1ccc2c(=O)c3cc(C)ccc3n(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C18H16F3NO/c1-3-12-5-6-13-16(9-12)22(10-18(19,20)21)15-7-4-11(2)8-14(15)17(13)23/h4-9H,3,10H2,1-2H3 |
| InChIKey | JKWQXSWBLLWCPC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one?
The IUPAC name of 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one (CID 121258325) is 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one.
What is the SMILES notation for 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one?
The canonical SMILES for 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one is CCc1ccc2c(=O)c3cc(C)ccc3n(CC(F)(F)F)c2c1.
What is the InChIKey of 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one?
The InChIKey is JKWQXSWBLLWCPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO/c1-3-12-5-6-13-16(9-12)22(10-18(19,20)21)15-7-4-11(2)8-14(15)17(13)23/h4-9H,3,10H2,1-2H3.
What are the key properties of 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one?
6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one has a molecular weight of 319.33 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-methyl-10-(2,2,2-trifluoroethyl)acridin-9-one is sourced from PubChem (CID 121258325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).