About 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one
4-acetyl-1-ethyl-2,3-dihydropyridin-6-one (PubChem CID 121258599) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one |
| PubChem CID | 121258599 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one |
| SMILES | CCN1CCC(C(C)=O)=CC1=O |
| InChI | InChI=1S/C9H13NO2/c1-3-10-5-4-8(7(2)11)6-9(10)12/h6H,3-5H2,1-2H3 |
| InChIKey | UWEPNNHVRSWOAC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one?
The IUPAC name of 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one (CID 121258599) is 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one.
What is the SMILES notation for 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one?
The canonical SMILES for 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one is CCN1CCC(C(C)=O)=CC1=O.
What is the InChIKey of 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one?
The InChIKey is UWEPNNHVRSWOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-3-10-5-4-8(7(2)11)6-9(10)12/h6H,3-5H2,1-2H3.
What are the key properties of 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one?
4-acetyl-1-ethyl-2,3-dihydropyridin-6-one has a molecular weight of 167.21 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-1-ethyl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 121258599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).