C19H26N4O2S — CID 121258915
N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-6-methylquinazolin-4-amine (PubChem CID 121258915) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-6-methylquinazolin-4-amine.
| Compound Name | N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-6-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 121258915 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-6-methylquinazolin-4-amine |
| SMILES | Cc1ccc2ncnc(NC3CCC(N4CCS(=O)(=O)CC4)CC3)c2c1 |
| InChI | InChI=1S/C19H26N4O2S/c1-14-2-7-18-17(12-14)19(21-13-20-18)22-15-3-5-16(6-4-15)23-8-10-26(24,25)11-9-23/h2,7,12-13,15-16H,3-6,8-11H2,1H3,(H,20,21,22) |
| InChIKey | LGNKVHCAYRXISB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |