About 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide
7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide (PubChem CID 121259169) has the molecular formula C7H7N5O
and a molecular weight of 177.17 g/mol. Its IUPAC name is 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide.
Molecular Properties
| Compound Name | 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide |
| PubChem CID | 121259169 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide |
| SMILES | NC(=O)c1c(N)ncn2ccnc12 |
| InChI | InChI=1S/C7H7N5O/c8-5-4(6(9)13)7-10-1-2-12(7)3-11-5/h1-3H,8H2,(H2,9,13) |
| InChIKey | JTBZWJDGGRSCGU-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide?
The IUPAC name of 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide (CID 121259169) is 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide.
What is the SMILES notation for 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide?
The canonical SMILES for 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide is NC(=O)c1c(N)ncn2ccnc12.
What is the InChIKey of 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide?
The InChIKey is JTBZWJDGGRSCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O/c8-5-4(6(9)13)7-10-1-2-12(7)3-11-5/h1-3H,8H2,(H2,9,13).
What are the key properties of 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide?
7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide has a molecular weight of 177.17 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminoimidazo[1,2-c]pyrimidine-8-carboxamide is sourced from PubChem (CID 121259169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).