C24H18N6OS — CID 121259552
2-amino-N-[(1R)-1-(3-ethynyl-5-phenylthieno[2,3-b]pyridin-6-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 121259552) has the molecular formula C24H18N6OS and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-amino-N-[(1R)-1-(3-ethynyl-5-phenylthieno[2,3-b]pyridin-6-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-N-[(1R)-1-(3-ethynyl-5-phenylthieno[2,3-b]pyridin-6-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 121259552 |
| Molecular Formula | C24H18N6OS |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-amino-N-[(1R)-1-(3-ethynyl-5-phenylthieno[2,3-b]pyridin-6-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C#Cc1csc2nc([C@@H](C)NC(=O)c3c(N)nn4cccnc34)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C24H18N6OS/c1-3-15-13-32-24-18(15)12-17(16-8-5-4-6-9-16)20(28-24)14(2)27-23(31)19-21(25)29-30-11-7-10-26-22(19)30/h1,4-14H,2H3,(H2,25,29)(H,27,31)/t14-/m1/s1 |
| InChIKey | FNDSPVWIBCPNGH-CQSZACIVSA-N |
| XLogP | 4.06 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|