About [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate
[2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate (PubChem CID 121259603) has the molecular formula C13H25NO5
and a molecular weight of 275.34 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate |
| PubChem CID | 121259603 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate |
| SMILES | CCC(CO)(COC(=O)NC)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO5/c1-6-13(7-15,9-19-11(17)14-5)8-18-10(16)12(2,3)4/h15H,6-9H2,1-5H3,(H,14,17) |
| InChIKey | YELMCFATTNZVPG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate?
The IUPAC name of [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate (CID 121259603) is [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate?
The canonical SMILES for [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate is CCC(CO)(COC(=O)NC)COC(=O)C(C)(C)C.
What is the InChIKey of [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate?
The InChIKey is YELMCFATTNZVPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO5/c1-6-13(7-15,9-19-11(17)14-5)8-18-10(16)12(2,3)4/h15H,6-9H2,1-5H3,(H,14,17).
What are the key properties of [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate?
[2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate has a molecular weight of 275.34 g/mol, XLogP of 1.32, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-2-(methylcarbamoyloxymethyl)butyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 121259603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).