C25H20N6O — CID 121259605
2-amino-N-[(1R)-1-(7-ethynyl-1-phenylindol-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 121259605) has the molecular formula C25H20N6O and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-amino-N-[(1R)-1-(7-ethynyl-1-phenylindol-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-N-[(1R)-1-(7-ethynyl-1-phenylindol-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 121259605 |
| Molecular Formula | C25H20N6O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-amino-N-[(1R)-1-(7-ethynyl-1-phenylindol-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C#Cc1cccc2cc([C@@H](C)NC(=O)c3c(N)nn4cccnc34)n(-c3ccccc3)c12 |
| InChI | InChI=1S/C25H20N6O/c1-3-17-9-7-10-18-15-20(31(22(17)18)19-11-5-4-6-12-19)16(2)28-25(32)21-23(26)29-30-14-8-13-27-24(21)30/h1,4-16H,2H3,(H2,26,29)(H,28,32)/t16-/m1/s1 |
| InChIKey | FTEMGXLKVNXWOH-MRXNPFEDSA-N |
| XLogP | 3.73 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|