About 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol
2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol (PubChem CID 12125964) has the molecular formula C36H40N6O
and a molecular weight of 572.70 g/mol. Its IUPAC name is 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-tert-butylphenol.
Molecular Properties
| Compound Name | 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol |
| PubChem CID | 12125964 |
| Molecular Formula | C36H40N6O |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-tert-butylphenol |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)CN(CC2=CC=CC=N2)CC3=CC=CC=N3)O)CN(CC4=CC=CC=N4)CC5=CC=CC=N5 |
| InChI | InChI=1S/C36H40N6O/c1-36(2,3)30-20-28(22-41(24-31-12-4-8-16-37-31)25-32-13-5-9-17-38-32)35(43)29(21-30)23-42(26-33-14-6-10-18-39-33)27-34-15-7-11-19-40-34/h4-21,43H,22-27H2,1-3H3 |
| InChIKey | HRJJQIQOJPDKPI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | 694 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol?
The IUPAC name of 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol (CID 12125964) is 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-tert-butylphenol.
What is the SMILES notation for 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol?
The canonical SMILES for 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol is CC(C)(C)C1=CC(=C(C(=C1)CN(CC2=CC=CC=N2)CC3=CC=CC=N3)O)CN(CC4=CC=CC=N4)CC5=CC=CC=N5.
What is the InChIKey of 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol?
The InChIKey is HRJJQIQOJPDKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H40N6O/c1-36(2,3)30-20-28(22-41(24-31-12-4-8-16-37-31)25-32-13-5-9-17-38-32)35(43)29(21-30)23-42(26-33-14-6-10-18-39-33)27-34-15-7-11-19-40-34/h4-21,43H,22-27H2,1-3H3.
What are the key properties of 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol?
2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol has a molecular weight of 572.70 g/mol, XLogP of 4.70, 13 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-Bis{bis(2-pyridylmethyl)aminomethyl}-4-t-butylphenol is sourced from PubChem (CID 12125964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).