About 2,3-di(propan-2-yl)-2H-1,3-thiazole
2,3-di(propan-2-yl)-2H-1,3-thiazole (PubChem CID 121260876) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-2H-1,3-thiazole |
| PubChem CID | 121260876 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2,3-di(propan-2-yl)-2H-1,3-thiazole |
| SMILES | CC(C)C1SC=CN1C(C)C |
| InChI | InChI=1S/C9H17NS/c1-7(2)9-10(8(3)4)5-6-11-9/h5-9H,1-4H3 |
| InChIKey | VTZMXUSWCUUTPC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-di(propan-2-yl)-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-2H-1,3-thiazole?
The IUPAC name of 2,3-di(propan-2-yl)-2H-1,3-thiazole (CID 121260876) is 2,3-di(propan-2-yl)-2H-1,3-thiazole.
What is the SMILES notation for 2,3-di(propan-2-yl)-2H-1,3-thiazole?
The canonical SMILES for 2,3-di(propan-2-yl)-2H-1,3-thiazole is CC(C)C1SC=CN1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-2H-1,3-thiazole?
The InChIKey is VTZMXUSWCUUTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-7(2)9-10(8(3)4)5-6-11-9/h5-9H,1-4H3.
What are the key properties of 2,3-di(propan-2-yl)-2H-1,3-thiazole?
2,3-di(propan-2-yl)-2H-1,3-thiazole has a molecular weight of 171.31 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-2H-1,3-thiazole is sourced from PubChem (CID 121260876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).