C29H34IN5O3S — CID 121260982
5-(iodomethyl)-2-N-[7-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-chromen-5-yl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 121260982) has the molecular formula C29H34IN5O3S and a molecular weight of 659.59 g/mol. Its IUPAC name is 5-(iodomethyl)-2-N-[7-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-chromen-5-yl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(iodomethyl)-2-N-[7-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-chromen-5-yl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 121260982 |
| Molecular Formula | C29H34IN5O3S |
| Molecular Weight | 659.59 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | 5-(iodomethyl)-2-N-[7-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-chromen-5-yl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncc(CI)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c2c(c1C1=CCNCC1)OCCC2 |
| InChI | InChI=1S/C29H34IN5O3S/c1-18(2)39(36,37)25-9-5-4-8-23(25)33-28-21(16-30)17-32-29(35-28)34-24-15-19(3)26(20-10-12-31-13-11-20)27-22(24)7-6-14-38-27/h4-5,8-10,15,17-18,31H,6-7,11-14,16H2,1-3H3,(H2,32,33,34,35) |
| InChIKey | PZWUYMJMAYVVHU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|