C9H16N2 — CID 121261261
3,3a,4,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-amine (PubChem CID 121261261) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3,3a,4,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-amine.
| Compound Name | 3,3a,4,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-amine |
|---|---|
| PubChem CID | 121261261 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3,3a,4,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-amine |
| SMILES | NN1CC2CC=CCCC2C1 |
| InChI | InChI=1S/C9H16N2/c10-11-6-8-4-2-1-3-5-9(8)7-11/h1-2,8-9H,3-7,10H2 |
| InChIKey | IBLFRZFLHDBZTD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|