About [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone
[(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone (PubChem CID 121261851) has the molecular formula C14H21F2N3O3
and a molecular weight of 317.34 g/mol. Its IUPAC name is [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone.
Molecular Properties
| Compound Name | [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone |
| PubChem CID | 121261851 |
| Molecular Formula | C14H21F2N3O3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone |
| SMILES | CC(C)O[C@H]1CCN(C(=O)c2ccnn2CCO)CC1(F)F |
| InChI | InChI=1S/C14H21F2N3O3/c1-10(2)22-12-4-6-18(9-14(12,15)16)13(21)11-3-5-17-19(11)7-8-20/h3,5,10,12,20H,4,6-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | WAEVGMZHJKTICD-LBPRGKRZSA-N |
| XLogP | 1.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone?
The IUPAC name of [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone (CID 121261851) is [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone.
What is the SMILES notation for [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone?
The canonical SMILES for [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone is CC(C)O[C@H]1CCN(C(=O)c2ccnn2CCO)CC1(F)F.
What is the InChIKey of [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone?
The InChIKey is WAEVGMZHJKTICD-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H21F2N3O3/c1-10(2)22-12-4-6-18(9-14(12,15)16)13(21)11-3-5-17-19(11)7-8-20/h3,5,10,12,20H,4,6-9H2,1-2H3/t12-/m0/s1.
What are the key properties of [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone?
[(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone has a molecular weight of 317.34 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-3,3-difluoro-4-propan-2-yloxypiperidin-1-yl]-[2-(2-hydroxyethyl)pyrazol-3-yl]methanone is sourced from PubChem (CID 121261851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).