C32H36FN7O4 — CID 121262149
5-[4-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]anilino]pyrimidin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 121262149) has the molecular formula C32H36FN7O4 and a molecular weight of 601.68 g/mol. Its IUPAC name is 5-[4-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]anilino]pyrimidin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile.
| Compound Name | 5-[4-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]anilino]pyrimidin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 121262149 |
| Molecular Formula | C32H36FN7O4 |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 5-[4-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]anilino]pyrimidin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | C[C@H](O)C(=O)N1CC[C@H](Oc2ccc(-c3nccc(Nc4ccc(N5CCN6CCOC[C@H]6C5)cc4)n3)cc2C#N)[C@H](F)C1 |
| InChI | InChI=1S/C32H36FN7O4/c1-21(41)32(42)40-11-9-29(27(33)19-40)44-28-7-2-22(16-23(28)17-34)31-35-10-8-30(37-31)36-24-3-5-25(6-4-24)39-13-12-38-14-15-43-20-26(38)18-39/h2-8,10,16,21,26-27,29,41H,9,11-15,18-20H2,1H3,(H,35,36,37)/t21-,26+,27+,29-/m0/s1 |
| InChIKey | QGXJVJZGFNZMJQ-YWFGUESBSA-N |
| XLogP | 2.98 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|