C30H42O7 — CID 121262643
(1S,2S,5S,8R,9R,14S,15R,21S)-21-butoxy-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one (PubChem CID 121262643) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is (1S,2S,5S,8R,9R,14S,15R,21S)-21-butoxy-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one.
| Compound Name | (1S,2S,5S,8R,9R,14S,15R,21S)-21-butoxy-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one |
|---|---|
| PubChem CID | 121262643 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | (1S,2S,5S,8R,9R,14S,15R,21S)-21-butoxy-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one |
| SMILES | C=C1C(=O)[C@@]23[C@@H]4OC(C)(C)OC25OC[C@]2(C6=C(CC[C@@H](OCCCC)O6)CC(C)(C)[C@H]2C5O)[C@@H]3CC[C@@H]14 |
| InChI | InChI=1S/C30H42O7/c1-7-8-13-33-20-12-9-17-14-26(3,4)21-23(32)30-29-19(28(21,15-34-30)24(17)35-20)11-10-18(16(2)22(29)31)25(29)36-27(5,6)37-30/h18-21,23,25,32H,2,7-15H2,1,3-6H3/t18-,19-,20-,21+,23?,25+,28-,29-,30?/m0/s1 |
| InChIKey | CPOFXUZSSSOISS-IWPJYVLOSA-N |
| XLogP | 4.63 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|