C21H22F3N5O3 — CID 121262754
N-[(3S)-7-amino-2-oxo-1-(2,3,6-trifluoro-5-methylphenoxy)heptan-3-yl]-3-azidobenzamide (PubChem CID 121262754) has the molecular formula C21H22F3N5O3 and a molecular weight of 449.43 g/mol. Its IUPAC name is N-[(3S)-7-amino-2-oxo-1-(2,3,6-trifluoro-5-methylphenoxy)heptan-3-yl]-3-azidobenzamide.
| Compound Name | N-[(3S)-7-amino-2-oxo-1-(2,3,6-trifluoro-5-methylphenoxy)heptan-3-yl]-3-azidobenzamide |
|---|---|
| PubChem CID | 121262754 |
| Molecular Formula | C21H22F3N5O3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[(3S)-7-amino-2-oxo-1-(2,3,6-trifluoro-5-methylphenoxy)heptan-3-yl]-3-azidobenzamide |
| SMILES | Cc1cc(F)c(F)c(OCC(=O)[C@H](CCCCN)NC(=O)c2cccc(N=[N+]=[N-])c2)c1F |
| InChI | InChI=1S/C21H22F3N5O3/c1-12-9-15(22)19(24)20(18(12)23)32-11-17(30)16(7-2-3-8-25)27-21(31)13-5-4-6-14(10-13)28-29-26/h4-6,9-10,16H,2-3,7-8,11,25H2,1H3,(H,27,31)/t16-/m0/s1 |
| InChIKey | DGUCBBSYEANYDN-INIZCTEOSA-N |
| XLogP | 4.23 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|