C18H16N4O4 — CID 121262811
11-(3-methoxycarbonylphenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-4-carboxylic acid (PubChem CID 121262811) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is 11-(3-methoxycarbonylphenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-4-carboxylic acid.
| Compound Name | 11-(3-methoxycarbonylphenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-4-carboxylic acid |
|---|---|
| PubChem CID | 121262811 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 11-(3-methoxycarbonylphenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-4-carboxylic acid |
| SMILES | COC(=O)c1cccc(N2CCc3c(cnc4cc(C(=O)O)nn34)C2)c1 |
| InChI | InChI=1S/C18H16N4O4/c1-26-18(25)11-3-2-4-13(7-11)21-6-5-15-12(10-21)9-19-16-8-14(17(23)24)20-22(15)16/h2-4,7-9H,5-6,10H2,1H3,(H,23,24) |
| InChIKey | SLFIEPXJIXDSKM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |