C24H29N3O4 — CID 121262952
tert-butyl N-[(10R,11E,14S)-17-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate (PubChem CID 121262952) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl N-[(10R,11E,14S)-17-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[(10R,11E,14S)-17-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate |
|---|---|
| PubChem CID | 121262952 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl N-[(10R,11E,14S)-17-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate |
| SMILES | COc1cc2cc(n1)[C@@H](NC(=O)OC(C)(C)C)C/C=C/[C@@H](C)C(=O)Nc1ccccc1-2 |
| InChI | InChI=1S/C24H29N3O4/c1-15-9-8-12-19(27-23(29)31-24(2,3)4)20-13-16(14-21(25-20)30-5)17-10-6-7-11-18(17)26-22(15)28/h6-11,13-15,19H,12H2,1-5H3,(H,26,28)(H,27,29)/b9-8+/t15-,19+/m1/s1 |
| InChIKey | QKYLEQQYLPHGJJ-GYHFNDTMSA-N |
| XLogP | 4.86 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|