C17H19NO5 — CID 121263067
prop-2-enyl 3-benzoyl-2,2,5-trimethyl-4-oxo-1,3-oxazolidine-5-carboxylate (PubChem CID 121263067) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is prop-2-enyl 3-benzoyl-2,2,5-trimethyl-4-oxo-1,3-oxazolidine-5-carboxylate.
| Compound Name | prop-2-enyl 3-benzoyl-2,2,5-trimethyl-4-oxo-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 121263067 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | prop-2-enyl 3-benzoyl-2,2,5-trimethyl-4-oxo-1,3-oxazolidine-5-carboxylate |
| SMILES | C=CCOC(=O)C1(C)OC(C)(C)N(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C17H19NO5/c1-5-11-22-15(21)17(4)14(20)18(16(2,3)23-17)13(19)12-9-7-6-8-10-12/h5-10H,1,11H2,2-4H3 |
| InChIKey | PETPKQQDZYHNOK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|