C20H20O4 — CID 121263954
6-(methoxymethyl)-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione (PubChem CID 121263954) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-(methoxymethyl)-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione.
| Compound Name | 6-(methoxymethyl)-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione |
|---|---|
| PubChem CID | 121263954 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6-(methoxymethyl)-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| SMILES | COCC1(C)CCCc2c1ccc1c2C(=O)C(=O)c2c(C)coc2-1 |
| InChI | InChI=1S/C20H20O4/c1-11-9-24-19-13-6-7-14-12(5-4-8-20(14,2)10-23-3)16(13)18(22)17(21)15(11)19/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | NSWMXVZTQCWSEF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|