C23H36N4O6S — CID 121264063
tert-butyl N-[(2R,7R)-14-amino-2,5-dimethyl-6,6-dioxo-6λ6-thia-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),3,12,14-tetraen-4-yl]-N-(2-methoxyethoxymethyl)carbamate (PubChem CID 121264063) has the molecular formula C23H36N4O6S and a molecular weight of 496.63 g/mol. Its IUPAC name is tert-butyl N-[(2R,7R)-14-amino-2,5-dimethyl-6,6-dioxo-6λ6-thia-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),3,12,14-tetraen-4-yl]-N-(2-methoxyethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[(2R,7R)-14-amino-2,5-dimethyl-6,6-dioxo-6λ6-thia-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),3,12,14-tetraen-4-yl]-N-(2-methoxyethoxymethyl)carbamate |
|---|---|
| PubChem CID | 121264063 |
| Molecular Formula | C23H36N4O6S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | tert-butyl N-[(2R,7R)-14-amino-2,5-dimethyl-6,6-dioxo-6λ6-thia-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),3,12,14-tetraen-4-yl]-N-(2-methoxyethoxymethyl)carbamate |
| SMILES | COCCOCN(C(=O)OC(C)(C)C)C1=N[C@]2(C)c3cc(N)ccc3CCC[C@H]2S(=O)(=O)N1C |
| InChI | InChI=1S/C23H36N4O6S/c1-22(2,3)33-21(28)27(15-32-13-12-31-6)20-25-23(4)18-14-17(24)11-10-16(18)8-7-9-19(23)34(29,30)26(20)5/h10-11,14,19H,7-9,12-13,15,24H2,1-6H3/t19-,23-/m1/s1 |
| InChIKey | DYPSMOWCJCAHDD-AUSIDOKSSA-N |
| XLogP | 2.68 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|