C19H20FN5O4S — CID 121264096
N-[(4aS,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-5-fluoropyridine-2-carboxamide (PubChem CID 121264096) has the molecular formula C19H20FN5O4S and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[(4aS,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[(4aS,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 121264096 |
| Molecular Formula | C19H20FN5O4S |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[(4aS,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-5-fluoropyridine-2-carboxamide |
| SMILES | CN1C(N)=N[C@]2(C)c3cc(NC(=O)c4ccc(F)cn4)ccc3OCC[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C19H20FN5O4S/c1-19-13-9-12(23-17(26)14-5-3-11(20)10-22-14)4-6-15(13)29-8-7-16(19)30(27,28)25(2)18(21)24-19/h3-6,9-10,16H,7-8H2,1-2H3,(H2,21,24)(H,23,26)/t16-,19+/m0/s1 |
| InChIKey | KKURNFJVRFPQSR-QFBILLFUSA-N |
| XLogP | 1.43 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |