C17H36N2O — CID 121265189
2-[butyl(3-methylbutyl)amino]-N-(3,3-dimethylbutyl)acetamide (PubChem CID 121265189) has the molecular formula C17H36N2O and a molecular weight of 284.49 g/mol. Its IUPAC name is 2-[butyl(3-methylbutyl)amino]-N-(3,3-dimethylbutyl)acetamide.
| Compound Name | 2-[butyl(3-methylbutyl)amino]-N-(3,3-dimethylbutyl)acetamide |
|---|---|
| PubChem CID | 121265189 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 2-[butyl(3-methylbutyl)amino]-N-(3,3-dimethylbutyl)acetamide |
| SMILES | CCCCN(CCC(C)C)CC(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C17H36N2O/c1-7-8-12-19(13-9-15(2)3)14-16(20)18-11-10-17(4,5)6/h15H,7-14H2,1-6H3,(H,18,20) |
| InChIKey | DYTFFPPVSBUNFE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |