C9H20FN5O2 — CID 121265358
2-amino-2-(diaminomethylamino)-1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]ethanone (PubChem CID 121265358) has the molecular formula C9H20FN5O2 and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-amino-2-(diaminomethylamino)-1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]ethanone.
| Compound Name | 2-amino-2-(diaminomethylamino)-1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 121265358 |
| Molecular Formula | C9H20FN5O2 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-amino-2-(diaminomethylamino)-1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]ethanone |
| SMILES | CO[C@H]1CCN(C(=O)C(N)NC(N)N)C[C@H]1F |
| InChI | InChI=1S/C9H20FN5O2/c1-17-6-2-3-15(4-5(6)10)8(16)7(11)14-9(12)13/h5-7,9,14H,2-4,11-13H2,1H3/t5-,6+,7?/m1/s1 |
| InChIKey | VZTZVMDTUVDNKW-JEAXJGTLSA-N |
| XLogP | -2.35 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|