About 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one
2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one (PubChem CID 121265401) has the molecular formula C10H19F2N3O2
and a molecular weight of 251.28 g/mol. Its IUPAC name is 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one.
Molecular Properties
| Compound Name | 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one |
| PubChem CID | 121265401 |
| Molecular Formula | C10H19F2N3O2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one |
| SMILES | CO[C@H]1CCN(C(=O)C(N)CCN)CC1(F)F |
| InChI | InChI=1S/C10H19F2N3O2/c1-17-8-3-5-15(6-10(8,11)12)9(16)7(14)2-4-13/h7-8H,2-6,13-14H2,1H3/t7?,8-/m0/s1 |
| InChIKey | ZXESBACZIPUEDR-MQWKRIRWSA-N |
| XLogP | -0.45 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one?
The IUPAC name of 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one (CID 121265401) is 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one.
What is the SMILES notation for 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one?
The canonical SMILES for 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one is CO[C@H]1CCN(C(=O)C(N)CCN)CC1(F)F.
What is the InChIKey of 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one?
The InChIKey is ZXESBACZIPUEDR-MQWKRIRWSA-N. The full InChI is InChI=1S/C10H19F2N3O2/c1-17-8-3-5-15(6-10(8,11)12)9(16)7(14)2-4-13/h7-8H,2-6,13-14H2,1H3/t7?,8-/m0/s1.
What are the key properties of 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one?
2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one has a molecular weight of 251.28 g/mol, XLogP of -0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-1-[(4S)-3,3-difluoro-4-methoxypiperidin-1-yl]butan-1-one is sourced from PubChem (CID 121265401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).