C20H16FNO3 — CID 121265956
2-(4-fluorophenyl)-N-methyl-7,10-dihydrofuro[3,2-g][1]benzoxepine-1-carboxamide (PubChem CID 121265956) has the molecular formula C20H16FNO3 and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methyl-7,10-dihydrofuro[3,2-g][1]benzoxepine-1-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methyl-7,10-dihydrofuro[3,2-g][1]benzoxepine-1-carboxamide |
|---|---|
| PubChem CID | 121265956 |
| Molecular Formula | C20H16FNO3 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methyl-7,10-dihydrofuro[3,2-g][1]benzoxepine-1-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc3c(c12)CC=CCO3 |
| InChI | InChI=1S/C20H16FNO3/c1-22-20(23)18-17-14-4-2-3-11-24-15(14)9-10-16(17)25-19(18)12-5-7-13(21)8-6-12/h2-3,5-10H,4,11H2,1H3,(H,22,23) |
| InChIKey | HIDBTSHKVROICO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|