C26H33FN6O — CID 121266090
N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]-6-[6-fluoro-5-(methylamino)-3-pyridinyl]quinazolin-4-amine (PubChem CID 121266090) has the molecular formula C26H33FN6O and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]-6-[6-fluoro-5-(methylamino)-3-pyridinyl]quinazolin-4-amine.
| Compound Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]-6-[6-fluoro-5-(methylamino)-3-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 121266090 |
| Molecular Formula | C26H33FN6O |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]-6-[6-fluoro-5-(methylamino)-3-pyridinyl]quinazolin-4-amine |
| SMILES | CNc1cc(-c2ccc3ncnc(NC4CCC(N5C[C@@H](C)O[C@@H](C)C5)CC4)c3c2)cnc1F |
| InChI | InChI=1S/C26H33FN6O/c1-16-13-33(14-17(2)34-16)21-7-5-20(6-8-21)32-26-22-10-18(4-9-23(22)30-15-31-26)19-11-24(28-3)25(27)29-12-19/h4,9-12,15-17,20-21,28H,5-8,13-14H2,1-3H3,(H,30,31,32)/t16-,17+,20?,21? |
| InChIKey | RIZXRNGNNOCOMW-AGXSTUJCSA-N |
| XLogP | 4.70 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|