C25H31FN6O — CID 121266113
6-[6-fluoro-5-(methylamino)-3-pyridinyl]-N-[4-[(2R)-2-methylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine (PubChem CID 121266113) has the molecular formula C25H31FN6O and a molecular weight of 450.56 g/mol. Its IUPAC name is 6-[6-fluoro-5-(methylamino)-3-pyridinyl]-N-[4-[(2R)-2-methylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine.
| Compound Name | 6-[6-fluoro-5-(methylamino)-3-pyridinyl]-N-[4-[(2R)-2-methylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 121266113 |
| Molecular Formula | C25H31FN6O |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 6-[6-fluoro-5-(methylamino)-3-pyridinyl]-N-[4-[(2R)-2-methylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine |
| SMILES | CNc1cc(-c2ccc3ncnc(NC4CCC(N5CCO[C@H](C)C5)CC4)c3c2)cnc1F |
| InChI | InChI=1S/C25H31FN6O/c1-16-14-32(9-10-33-16)20-6-4-19(5-7-20)31-25-21-11-17(3-8-22(21)29-15-30-25)18-12-23(27-2)24(26)28-13-18/h3,8,11-13,15-16,19-20,27H,4-7,9-10,14H2,1-2H3,(H,29,30,31)/t16-,19?,20?/m1/s1 |
| InChIKey | CILQDKATQFNLIC-PBPGXSGUSA-N |
| XLogP | 4.32 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|