C29H41NO8S — CID 121266194
[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 5-[3-[(2S)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate (PubChem CID 121266194) has the molecular formula C29H41NO8S and a molecular weight of 563.71 g/mol. Its IUPAC name is [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 5-[3-[(2S)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate.
| Compound Name | [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 5-[3-[(2S)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 121266194 |
| Molecular Formula | C29H41NO8S |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 5-[3-[(2S)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCC[C@H](O)c1ccc(N2C(=O)CC[C@@H]2CCCc2ccc(C(=O)OC[C@H](O)[C@H](O)[C@H](O)CO)s2)cc1 |
| InChI | InChI=1S/C29H41NO8S/c1-2-3-4-8-23(32)19-9-11-21(12-10-19)30-20(13-16-27(30)35)6-5-7-22-14-15-26(39-22)29(37)38-18-25(34)28(36)24(33)17-31/h9-12,14-15,20,23-25,28,31-34,36H,2-8,13,16-18H2,1H3/t20-,23-,24+,25-,28+/m0/s1 |
| InChIKey | SUZRRBQYPPGNJP-JXHWXAOWSA-N |
| XLogP | 3.11 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|