About 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid
4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 121266866) has the molecular formula C16H17N5O5S
and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid |
| PubChem CID | 121266866 |
| Molecular Formula | C16H17N5O5S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccccc1CN1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C16H17N5O5S/c22-14(18-15-17-9-13(27-15)21(25)26)12-4-2-1-3-11(12)10-19-5-7-20(8-6-19)16(23)24/h1-4,9H,5-8,10H2,(H,23,24)(H,17,18,22) |
| InChIKey | OHNPRQAXPCZKCT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid?
The IUPAC name of 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid (CID 121266866) is 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid.
What is the SMILES notation for 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid?
The canonical SMILES for 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid is O=C(Nc1ncc([N+](=O)[O-])s1)c1ccccc1CN1CCN(C(=O)O)CC1.
What is the InChIKey of 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid?
The InChIKey is OHNPRQAXPCZKCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O5S/c22-14(18-15-17-9-13(27-15)21(25)26)12-4-2-1-3-11(12)10-19-5-7-20(8-6-19)16(23)24/h1-4,9H,5-8,10H2,(H,23,24)(H,17,18,22).
What are the key properties of 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid?
4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid has a molecular weight of 391.41 g/mol, XLogP of 2.10, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl]methyl]piperazine-1-carboxylic acid is sourced from PubChem (CID 121266866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).