About [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea
[(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea (PubChem CID 121266876) has the molecular formula C9H19N3S
and a molecular weight of 201.34 g/mol. Its IUPAC name is [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea.
Molecular Properties
| Compound Name | [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea |
| PubChem CID | 121266876 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea |
| SMILES | CCCC(C)(C)/C(C)=N\NC(N)=S |
| InChI | InChI=1S/C9H19N3S/c1-5-6-9(3,4)7(2)11-12-8(10)13/h5-6H2,1-4H3,(H3,10,12,13)/b11-7- |
| InChIKey | HRGGCBBTMPXXGK-XFFZJAGNSA-N |
| XLogP | 2.02 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea?
The IUPAC name of [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea (CID 121266876) is [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea.
What is the SMILES notation for [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea?
The canonical SMILES for [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea is CCCC(C)(C)/C(C)=N\NC(N)=S.
What is the InChIKey of [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea?
The InChIKey is HRGGCBBTMPXXGK-XFFZJAGNSA-N. The full InChI is InChI=1S/C9H19N3S/c1-5-6-9(3,4)7(2)11-12-8(10)13/h5-6H2,1-4H3,(H3,10,12,13)/b11-7-.
What are the key properties of [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea?
[(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea has a molecular weight of 201.34 g/mol, XLogP of 2.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3,3-dimethylhexan-2-ylideneamino]thiourea is sourced from PubChem (CID 121266876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).