About 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid
3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid (PubChem CID 121267060) has the molecular formula C20H29N3O4
and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid |
| PubChem CID | 121267060 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid |
| SMILES | C=CC1CCCCNC1=O.C=CCNC(=CC(=O)O)C1CCN(C=C)C1=O |
| InChI | InChI=1S/C12H16N2O3.C8H13NO/c1-3-6-13-10(8-11(15)16)9-5-7-14(4-2)12(9)17;1-2-7-5-3-4-6-9-8(7)10/h3-4,8-9,13H,1-2,5-7H2,(H,15,16);2,7H,1,3-6H2,(H,9,10) |
| InChIKey | CTASUOSENRBUNP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid?
The IUPAC name of 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid (CID 121267060) is 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid.
What is the SMILES notation for 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid?
The canonical SMILES for 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid is C=CC1CCCCNC1=O.C=CCNC(=CC(=O)O)C1CCN(C=C)C1=O.
What is the InChIKey of 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid?
The InChIKey is CTASUOSENRBUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3.C8H13NO/c1-3-6-13-10(8-11(15)16)9-5-7-14(4-2)12(9)17;1-2-7-5-3-4-6-9-8(7)10/h3-4,8-9,13H,1-2,5-7H2,(H,15,16);2,7H,1,3-6H2,(H,9,10).
What are the key properties of 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid?
3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid has a molecular weight of 375.47 g/mol, XLogP of 1.81, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylazepan-2-one;3-(1-ethenyl-2-oxopyrrolidin-3-yl)-3-(prop-2-enylamino)prop-2-enoic acid is sourced from PubChem (CID 121267060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).