C20H27Cl2N7 — CID 121267176
2-[4-[3-(propylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]benzene-1,3-diamine;dihydrochloride (PubChem CID 121267176) has the molecular formula C20H27Cl2N7 and a molecular weight of 436.39 g/mol. Its IUPAC name is 2-[4-[3-(propylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]benzene-1,3-diamine;dihydrochloride.
| Compound Name | 2-[4-[3-(propylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]benzene-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 121267176 |
| Molecular Formula | C20H27Cl2N7 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[4-[3-(propylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]benzene-1,3-diamine;dihydrochloride |
| SMILES | CCCNC1CCN(c2nc(-c3c(N)cccc3N)nc3cccnc23)C1.Cl.Cl |
| InChI | InChI=1S/C20H25N7.2ClH/c1-2-9-23-13-8-11-27(12-13)20-18-16(7-4-10-24-18)25-19(26-20)17-14(21)5-3-6-15(17)22;;/h3-7,10,13,23H,2,8-9,11-12,21-22H2,1H3;2*1H |
| InChIKey | CXJBIMQOCCLJDO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|